C13H26F3NO2 — CID 164556173
ethane;3-hydroxy-N-propyl-3-(trifluoromethyl)cyclobutane-1-carboxamide (PubChem CID 164556173) has the molecular formula C13H26F3NO2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethane;3-hydroxy-N-propyl-3-(trifluoromethyl)cyclobutane-1-carboxamide.
| Compound Name | ethane;3-hydroxy-N-propyl-3-(trifluoromethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 164556173 |
| Molecular Formula | C13H26F3NO2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethane;3-hydroxy-N-propyl-3-(trifluoromethyl)cyclobutane-1-carboxamide |
| SMILES | CC.CC.CCCNC(=O)C1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO2.2C2H6/c1-2-3-13-7(14)6-4-8(15,5-6)9(10,11)12;2*1-2/h6,15H,2-5H2,1H3,(H,13,14);2*1-2H3 |
| InChIKey | NSCISJGGCYSTTK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |