C15H28F3NO2 — CID 167298989
4-methyl-N-(5,5,5-trifluoro-4-hydroxy-4-methylpentyl)octanamide (PubChem CID 167298989) has the molecular formula C15H28F3NO2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-methyl-N-(5,5,5-trifluoro-4-hydroxy-4-methylpentyl)octanamide.
| Compound Name | 4-methyl-N-(5,5,5-trifluoro-4-hydroxy-4-methylpentyl)octanamide |
|---|---|
| PubChem CID | 167298989 |
| Molecular Formula | C15H28F3NO2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 4-methyl-N-(5,5,5-trifluoro-4-hydroxy-4-methylpentyl)octanamide |
| SMILES | CCCCC(C)CCC(=O)NCCCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H28F3NO2/c1-4-5-7-12(2)8-9-13(20)19-11-6-10-14(3,21)15(16,17)18/h12,21H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | YFYCLOURDMKUDH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|