C11H18F3NO2 — CID 164821544
3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)cyclobutane-1-carboxamide (PubChem CID 164821544) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)cyclobutane-1-carboxamide.
| Compound Name | 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 164821544 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)cyclobutane-1-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)C1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H18F3NO2/c1-6(2)7(3)15-9(16)8-4-10(17,5-8)11(12,13)14/h6-8,17H,4-5H2,1-3H3,(H,15,16)/t7-,8?,10?/m1/s1 |
| InChIKey | VVHDELOLNWUKFY-ZNFPMYQNSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |