C9H14F3NO2 — CID 167018545
N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]-2-methylpropanamide (PubChem CID 167018545) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]-2-methylpropanamide.
| Compound Name | N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 167018545 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[3-hydroxy-3-(trifluoromethyl)cyclobutyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO2/c1-5(2)7(14)13-6-3-8(15,4-6)9(10,11)12/h5-6,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | GZJCMHDHPRCFSK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |