About CID 164557825
CID 164557825 (PubChem CID 164557825) has the molecular formula C10H15GaN2
and a molecular weight of 232.97 g/mol.
Molecular Properties
| Compound Name | CID 164557825 |
| PubChem CID | 164557825 |
| Molecular Formula | C10H15GaN2 |
| Molecular Weight | 232.97 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | — |
| SMILES | CC.Cc1nnc([Ga])cc1C1CC1 |
| InChI | InChI=1S/C8H9N2.C2H6.Ga/c1-6-8(7-2-3-7)4-5-9-10-6;1-2;/h4,7H,2-3H2,1H3;1-2H3; |
| InChIKey | MKTCFZYTTFXDFZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.97 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 164557825 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164557825?
The IUPAC name of CID 164557825 (CID 164557825) is not available.
What is the SMILES notation for CID 164557825?
The canonical SMILES for CID 164557825 is CC.Cc1nnc([Ga])cc1C1CC1.
What is the InChIKey of CID 164557825?
The InChIKey is MKTCFZYTTFXDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2.C2H6.Ga/c1-6-8(7-2-3-7)4-5-9-10-6;1-2;/h4,7H,2-3H2,1H3;1-2H3;.
What are the key properties of CID 164557825?
CID 164557825 has a molecular weight of 232.97 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164557825 is sourced from PubChem (CID 164557825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).