C17H20 — CID 134939192
(5S,8R)-3-methylpentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene (PubChem CID 134939192) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is (5S,8R)-3-methylpentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene.
| Compound Name | (5S,8R)-3-methylpentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene |
|---|---|
| PubChem CID | 134939192 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (5S,8R)-3-methylpentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene |
| SMILES | Cc1c2c(cc3c1[C@H]1CC[C@@H]3C1)C1CCC2C1 |
| InChI | InChI=1S/C17H20/c1-9-16-12-4-2-10(6-12)14(16)8-15-11-3-5-13(7-11)17(9)15/h8,10-13H,2-7H2,1H3/t10-,11?,12+,13?/m1/s1 |
| InChIKey | PQTHPBIQSMVYBZ-IGJPJIBNSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |