About (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne
(1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne (PubChem CID 11275064) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne.
Analyze (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne?
The IUPAC name of (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne (CID 11275064) is (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne.
What is the SMILES notation for (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne?
The canonical SMILES for (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne is c1cc2c(cc#1)[C@H]1CC[C@@H]2C1.
What is the InChIKey of (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne?
The InChIKey is DVWAWVAELVFMEO-DTORHVGOSA-N. The full InChI is InChI=1S/C11H10/c1-2-4-11-9-6-5-8(7-9)10(11)3-1/h3-4,8-9H,5-7H2/t8-,9+.
What are the key properties of (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne?
(1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne has a molecular weight of 142.20 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8R)-tricyclo[6.2.1.02,7]undeca-2,6-dien-4-yne is sourced from PubChem (CID 11275064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).