About 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene
4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 23246623) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
Analyze 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The IUPAC name of 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (CID 23246623) is 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
What is the SMILES notation for 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The canonical SMILES for 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is Cc1cc(C)c2c(n1)C1CCC2C1.
What is the InChIKey of 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The InChIKey is FNZYLNFRIZLSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-7-5-8(2)13-12-10-4-3-9(6-10)11(7)12/h5,9-10H,3-4,6H2,1-2H3.
What are the key properties of 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene has a molecular weight of 173.26 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is sourced from PubChem (CID 23246623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).