C21H17F2NO2 — CID 164560615
1-[5-[2-(2,5-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylic acid (PubChem CID 164560615) has the molecular formula C21H17F2NO2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1-[5-[2-(2,5-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylic acid.
| Compound Name | 1-[5-[2-(2,5-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164560615 |
| Molecular Formula | C21H17F2NO2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[5-[2-(2,5-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C2CCc3cc(C#Cc4cc(F)ccc4F)ccc32)C1 |
| InChI | InChI=1S/C21H17F2NO2/c22-17-5-7-19(23)15(10-17)3-1-13-2-6-18-14(9-13)4-8-20(18)24-11-16(12-24)21(25)26/h2,5-7,9-10,16,20H,4,8,11-12H2,(H,25,26) |
| InChIKey | DCRHXUFUMXJXJX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|