C25H24FNO2 — CID 174225697
(1S,5R)-3-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 174225697) has the molecular formula C25H24FNO2 and a molecular weight of 389.47 g/mol. Its IUPAC name is (1S,5R)-3-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,5R)-3-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 174225697 |
| Molecular Formula | C25H24FNO2 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (1S,5R)-3-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | O=C(O)C1[C@@H]2CC[C@H]1CN(C1CCc3cc(C#Cc4cccc(F)c4)ccc31)C2 |
| InChI | InChI=1S/C25H24FNO2/c26-21-3-1-2-16(13-21)4-5-17-6-10-22-18(12-17)9-11-23(22)27-14-19-7-8-20(15-27)24(19)25(28)29/h1-3,6,10,12-13,19-20,23-24H,7-9,11,14-15H2,(H,28,29)/t19-,20+,23?,24? |
| InChIKey | ZIKGBROTRHCZJZ-TUUBTQOTSA-N |
| XLogP | 4.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|