C24H22FNO2 — CID 164560738
methyl 4-[[[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]amino]methyl]cyclobut-2-ene-1-carboxylate (PubChem CID 164560738) has the molecular formula C24H22FNO2 and a molecular weight of 375.44 g/mol. Its IUPAC name is methyl 4-[[[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]amino]methyl]cyclobut-2-ene-1-carboxylate.
| Compound Name | methyl 4-[[[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]amino]methyl]cyclobut-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 164560738 |
| Molecular Formula | C24H22FNO2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | methyl 4-[[[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]amino]methyl]cyclobut-2-ene-1-carboxylate |
| SMILES | COC(=O)C1C=CC1CNC1CCc2cc(C#Cc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C24H22FNO2/c1-28-24(27)22-11-8-19(22)15-26-23-12-9-18-13-17(7-10-21(18)23)6-5-16-3-2-4-20(25)14-16/h2-4,7-8,10-11,13-14,19,22-23,26H,9,12,15H2,1H3 |
| InChIKey | UTFKVLOCUBXBGP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|