C25H26FNO2 — CID 164560712
1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperidine-4-carboxylic acid (PubChem CID 164560712) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperidine-4-carboxylic acid.
| Compound Name | 1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 164560712 |
| Molecular Formula | C25H26FNO2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[5-[2-(3-fluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperidine-4-carboxylic acid |
| SMILES | CC1(C)CN(C2CCc3cc(C#Cc4cccc(F)c4)ccc32)CCC1C(=O)O |
| InChI | InChI=1S/C25H26FNO2/c1-25(2)16-27(13-12-22(25)24(28)29)23-11-9-19-14-18(8-10-21(19)23)7-6-17-4-3-5-20(26)15-17/h3-5,8,10,14-15,22-23H,9,11-13,16H2,1-2H3,(H,28,29) |
| InChIKey | ZLVWATHQQXMFST-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|