C21H19FN2O2 — CID 71767841
methyl (6aR,9aR)-3-[2-(3-fluorophenyl)ethynyl]-5,6,6a,8,9,9a-hexahydropyrrolo[2,3-h]quinoline-7-carboxylate (PubChem CID 71767841) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is methyl (6aR,9aR)-3-[2-(3-fluorophenyl)ethynyl]-5,6,6a,8,9,9a-hexahydropyrrolo[2,3-h]quinoline-7-carboxylate.
| Compound Name | methyl (6aR,9aR)-3-[2-(3-fluorophenyl)ethynyl]-5,6,6a,8,9,9a-hexahydropyrrolo[2,3-h]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 71767841 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | methyl (6aR,9aR)-3-[2-(3-fluorophenyl)ethynyl]-5,6,6a,8,9,9a-hexahydropyrrolo[2,3-h]quinoline-7-carboxylate |
| SMILES | COC(=O)N1CC[C@H]2c3ncc(C#Cc4cccc(F)c4)cc3CC[C@H]21 |
| InChI | InChI=1S/C21H19FN2O2/c1-26-21(25)24-10-9-18-19(24)8-7-16-11-15(13-23-20(16)18)6-5-14-3-2-4-17(22)12-14/h2-4,11-13,18-19H,7-10H2,1H3/t18-,19-/m1/s1 |
| InChIKey | XKXPYUNJNCNQSO-RTBURBONSA-N |
| XLogP | 3.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|