C22H20N2O — CID 164561329
4-[(1R,3R)-2-cyclobuta-1,2-dien-1-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol (PubChem CID 164561329) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[(1R,3R)-2-cyclobuta-1,2-dien-1-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol.
| Compound Name | 4-[(1R,3R)-2-cyclobuta-1,2-dien-1-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
|---|---|
| PubChem CID | 164561329 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[(1R,3R)-2-cyclobuta-1,2-dien-1-yl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(O)cc2)N1C1=C=CC1 |
| InChI | InChI=1S/C22H20N2O/c1-14-13-19-18-7-2-3-8-20(18)23-21(19)22(24(14)16-5-4-6-16)15-9-11-17(25)12-10-15/h2-4,7-12,14,22-23,25H,5,13H2,1H3/t14-,22-/m1/s1 |
| InChIKey | LRICDNRIUWNQTP-JLCFBVMHSA-N |
| XLogP | 4.65 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|