C17H18Cl2N2O2 — CID 164562299
5-(4-amino-2,6-dichlorophenoxy)-1-cyclopentyl-3-methylpyridin-2-one (PubChem CID 164562299) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 5-(4-amino-2,6-dichlorophenoxy)-1-cyclopentyl-3-methylpyridin-2-one.
| Compound Name | 5-(4-amino-2,6-dichlorophenoxy)-1-cyclopentyl-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 164562299 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-(4-amino-2,6-dichlorophenoxy)-1-cyclopentyl-3-methylpyridin-2-one |
| SMILES | Cc1cc(Oc2c(Cl)cc(N)cc2Cl)cn(C2CCCC2)c1=O |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-10-6-13(9-21(17(10)22)12-4-2-3-5-12)23-16-14(18)7-11(20)8-15(16)19/h6-9,12H,2-5,20H2,1H3 |
| InChIKey | GGKGGAYECOGDJG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|