About 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one
1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one (PubChem CID 175762742) has the molecular formula C17H19Cl2N3O2
and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one |
| PubChem CID | 175762742 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one |
| SMILES | Cc1cc(Oc2c(Cl)cc(NN)cc2Cl)cn(C2CCCC2)c1=O |
| InChI | InChI=1S/C17H19Cl2N3O2/c1-10-6-13(9-22(17(10)23)12-4-2-3-5-12)24-16-14(18)7-11(21-20)8-15(16)19/h6-9,12,21H,2-5,20H2,1H3 |
| InChIKey | GYPWCMYMUHIQBD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one?
The IUPAC name of 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one (CID 175762742) is 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one.
What is the SMILES notation for 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one?
The canonical SMILES for 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one is Cc1cc(Oc2c(Cl)cc(NN)cc2Cl)cn(C2CCCC2)c1=O.
What is the InChIKey of 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one?
The InChIKey is GYPWCMYMUHIQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2N3O2/c1-10-6-13(9-22(17(10)23)12-4-2-3-5-12)24-16-14(18)7-11(21-20)8-15(16)19/h6-9,12,21H,2-5,20H2,1H3.
What are the key properties of 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one?
1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one has a molecular weight of 368.26 g/mol, XLogP of 4.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-5-(2,6-dichloro-4-hydrazinylphenoxy)-3-methylpyridin-2-one is sourced from PubChem (CID 175762742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).