C17H13ClF3N3O — CID 164564411
5-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide (PubChem CID 164564411) has the molecular formula C17H13ClF3N3O and a molecular weight of 367.76 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide.
| Compound Name | 5-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 164564411 |
| Molecular Formula | C17H13ClF3N3O |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nc(Cl)cc2cc[nH]c12)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C17H13ClF3N3O/c1-8(10-3-2-4-11(13(10)19)16(20)21)23-17(25)15-14-9(5-6-22-14)7-12(18)24-15/h2-8,16,22H,1H3,(H,23,25)/t8-/m1/s1 |
| InChIKey | CSHDLUBSTPZPHX-MRVPVSSYSA-N |
| XLogP | 4.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|