C19H18ClF3N4O2 — CID 177158092
(2S,7S)-12-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-8,10,12-triene-10-carboxamide (PubChem CID 177158092) has the molecular formula C19H18ClF3N4O2 and a molecular weight of 426.83 g/mol. Its IUPAC name is (2S,7S)-12-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-8,10,12-triene-10-carboxamide.
| Compound Name | (2S,7S)-12-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-8,10,12-triene-10-carboxamide |
|---|---|
| PubChem CID | 177158092 |
| Molecular Formula | C19H18ClF3N4O2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (2S,7S)-12-chloro-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-8,10,12-triene-10-carboxamide |
| SMILES | C[C@@H](NC(=O)C1=CC(Cl)=NN2C1=N[C@@H]1COCC[C@@H]12)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C19H18ClF3N4O2/c1-9(10-3-2-4-11(16(10)21)17(22)23)24-19(28)12-7-15(20)26-27-14-5-6-29-8-13(14)25-18(12)27/h2-4,7,9,13-14,17H,5-6,8H2,1H3,(H,24,28)/t9-,13-,14+/m1/s1 |
| InChIKey | KUDGDPZLLXOYSQ-FZQKWOKYSA-N |
| XLogP | 3.30 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |