C25H30F2N5O4+ — CID 164564445
4-(1-acetylpiperidin-4-yl)oxy-5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]-1-hydroxy-N-[(4-methylphenyl)methyl]pyridin-1-ium-2-carboxamide (PubChem CID 164564445) has the molecular formula C25H30F2N5O4+ and a molecular weight of 502.54 g/mol. Its IUPAC name is 4-(1-acetylpiperidin-4-yl)oxy-5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]-1-hydroxy-N-[(4-methylphenyl)methyl]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-(1-acetylpiperidin-4-yl)oxy-5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]-1-hydroxy-N-[(4-methylphenyl)methyl]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 164564445 |
| Molecular Formula | C25H30F2N5O4+ |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 4-(1-acetylpiperidin-4-yl)oxy-5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]-1-hydroxy-N-[(4-methylphenyl)methyl]pyridin-1-ium-2-carboxamide |
| SMILES | CC(=O)N1CCC(Oc2cc(C(=O)NCc3ccc(C)cc3)[n+](O)cc2C(=C/N)/C=N/C(F)F)CC1 |
| InChI | InChI=1S/C25H29F2N5O4/c1-16-3-5-18(6-4-16)13-29-24(34)22-11-23(36-20-7-9-31(10-8-20)17(2)33)21(15-32(22)35)19(12-28)14-30-25(26)27/h3-6,11-12,14-15,20,25H,7-10,13H2,1-2H3,(H3-,28,29,30,34,35)/p+1 |
| InChIKey | NPIPGUJLXXTSIK-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|