C21H23ClN3O5+ — CID 170938836
4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-1-hydroxy-5-methylpyridin-1-ium-2-carboxamide (PubChem CID 170938836) has the molecular formula C21H23ClN3O5+ and a molecular weight of 432.88 g/mol. Its IUPAC name is 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-1-hydroxy-5-methylpyridin-1-ium-2-carboxamide.
| Compound Name | 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-1-hydroxy-5-methylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170938836 |
| Molecular Formula | C21H23ClN3O5+ |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-1-hydroxy-5-methylpyridin-1-ium-2-carboxamide |
| SMILES | Cc1c[n+](O)c(C(=O)NCc2ccc(Cl)cc2)cc1O[C@H]1CCN2C(=O)OC[C@@H]2C1 |
| InChI | InChI=1S/C21H22ClN3O5/c1-13-11-25(28)18(20(26)23-10-14-2-4-15(22)5-3-14)9-19(13)30-17-6-7-24-16(8-17)12-29-21(24)27/h2-5,9,11,16-17H,6-8,10,12H2,1H3,(H-,23,26,28)/p+1/t16-,17-/m0/s1 |
| InChIKey | CAKRRUKWVVLMQU-IRXDYDNUSA-O |
| XLogP | 2.47 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|