C22H20ClN3O4 — CID 170938985
4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-ethynylpyridine-2-carboxamide (PubChem CID 170938985) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-ethynylpyridine-2-carboxamide.
| Compound Name | 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-ethynylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170938985 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-ethynylpyridine-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)NCc2ccc(Cl)cc2)cc1O[C@H]1CCN2C(=O)OC[C@@H]2C1 |
| InChI | InChI=1S/C22H20ClN3O4/c1-2-15-12-24-19(21(27)25-11-14-3-5-16(23)6-4-14)10-20(15)30-18-7-8-26-17(9-18)13-29-22(26)28/h1,3-6,10,12,17-18H,7-9,11,13H2,(H,25,27)/t17-,18-/m0/s1 |
| InChIKey | SBQRDSFXEQWXLA-ROUUACIJSA-N |
| XLogP | 3.01 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|