C21H21BrClN3O4 — CID 170938861
4-[[(8S,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-8-yl]oxy]-5-bromo-N-[(4-chlorophenyl)methyl]pyridine-2-carboxamide (PubChem CID 170938861) has the molecular formula C21H21BrClN3O4 and a molecular weight of 494.77 g/mol. Its IUPAC name is 4-[[(8S,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-8-yl]oxy]-5-bromo-N-[(4-chlorophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-[[(8S,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-8-yl]oxy]-5-bromo-N-[(4-chlorophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170938861 |
| Molecular Formula | C21H21BrClN3O4 |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-[[(8S,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-8-yl]oxy]-5-bromo-N-[(4-chlorophenyl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(O[C@H]2CCN3C(=O)COC[C@@H]3C2)c(Br)cn1 |
| InChI | InChI=1S/C21H21BrClN3O4/c22-17-10-24-18(21(28)25-9-13-1-3-14(23)4-2-13)8-19(17)30-16-5-6-26-15(7-16)11-29-12-20(26)27/h1-4,8,10,15-16H,5-7,9,11-12H2,(H,25,28)/t15-,16-/m0/s1 |
| InChIKey | RQRDBVHTLZATLG-HOTGVXAUSA-N |
| XLogP | 3.20 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |