C25H26ClN5O3 — CID 170938834
4-[[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 170938834) has the molecular formula C25H26ClN5O3 and a molecular weight of 479.97 g/mol. Its IUPAC name is 4-[[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)pyridine-2-carboxamide.
| Compound Name | 4-[[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170938834 |
| Molecular Formula | C25H26ClN5O3 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2cnc(C(=O)NCc3ccc(Cl)cc3)cc2O[C@H]2CCN3C(=O)CC[C@H]3C2)cn1 |
| InChI | InChI=1S/C25H26ClN5O3/c1-30-15-17(13-29-30)21-14-27-22(25(33)28-12-16-2-4-18(26)5-3-16)11-23(21)34-20-8-9-31-19(10-20)6-7-24(31)32/h2-5,11,13-15,19-20H,6-10,12H2,1H3,(H,28,33)/t19-,20-/m0/s1 |
| InChIKey | KSVBJQUPXGXGGN-PMACEKPBSA-N |
| XLogP | 3.60 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |