C25H37NO3 — CID 164565518
ethane;3-methyl-N-(4-methylphenyl)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide (PubChem CID 164565518) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is ethane;3-methyl-N-(4-methylphenyl)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide.
| Compound Name | ethane;3-methyl-N-(4-methylphenyl)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide |
|---|---|
| PubChem CID | 164565518 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | ethane;3-methyl-N-(4-methylphenyl)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide |
| SMILES | CC.CC.CC1=C(C)C(=O)C(C(C)(C)CC(=O)Nc2ccc(C)cc2)=C(C)C1=O |
| InChI | InChI=1S/C21H25NO3.2C2H6/c1-12-7-9-16(10-8-12)22-17(23)11-21(5,6)18-15(4)19(24)13(2)14(3)20(18)25;2*1-2/h7-10H,11H2,1-6H3,(H,22,23);2*1-2H3 |
| InChIKey | CTQSBXOBSJJGTA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|