About N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide
N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 164567526) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 164567526 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cc3cn(C4CCCCC4)nc3cc2C(C)(C)O)co1 |
| InChI | InChI=1S/C21H26N4O3/c1-13-22-19(12-28-13)20(26)23-18-9-14-11-25(15-7-5-4-6-8-15)24-17(14)10-16(18)21(2,3)27/h9-12,15,27H,4-8H2,1-3H3,(H,23,26) |
| InChIKey | MXKXJDMZROZQLK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide (CID 164567526) is N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide is Cc1nc(C(=O)Nc2cc3cn(C4CCCCC4)nc3cc2C(C)(C)O)co1.
What is the InChIKey of N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide?
The InChIKey is MXKXJDMZROZQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c1-13-22-19(12-28-13)20(26)23-18-9-14-11-25(15-7-5-4-6-8-15)24-17(14)10-16(18)21(2,3)27/h9-12,15,27H,4-8H2,1-3H3,(H,23,26).
What are the key properties of N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide?
N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide has a molecular weight of 382.46 g/mol, XLogP of 4.32, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 164567526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).