C23H25Cl2N3O2 — CID 155751992
3,4-dichloro-N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]benzamide (PubChem CID 155751992) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]benzamide |
|---|---|
| PubChem CID | 155751992 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3,4-dichloro-N-[2-cyclohexyl-6-(2-hydroxypropan-2-yl)indazol-5-yl]benzamide |
| SMILES | CC(C)(O)c1cc2nn(C3CCCCC3)cc2cc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl2N3O2/c1-23(2,30)17-12-20-15(13-28(27-20)16-6-4-3-5-7-16)11-21(17)26-22(29)14-8-9-18(24)19(25)10-14/h8-13,16,30H,3-7H2,1-2H3,(H,26,29) |
| InChIKey | RYPNJFUQDRCCEY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |