C21H29F2N5O2 — CID 164568571
4-[4-amino-3-(difluoromethoxy)phenyl]-N-[4-[(dimethylamino)methyl]-2-methoxyphenyl]piperazin-1-amine (PubChem CID 164568571) has the molecular formula C21H29F2N5O2 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-[4-amino-3-(difluoromethoxy)phenyl]-N-[4-[(dimethylamino)methyl]-2-methoxyphenyl]piperazin-1-amine.
| Compound Name | 4-[4-amino-3-(difluoromethoxy)phenyl]-N-[4-[(dimethylamino)methyl]-2-methoxyphenyl]piperazin-1-amine |
|---|---|
| PubChem CID | 164568571 |
| Molecular Formula | C21H29F2N5O2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-[4-amino-3-(difluoromethoxy)phenyl]-N-[4-[(dimethylamino)methyl]-2-methoxyphenyl]piperazin-1-amine |
| SMILES | COc1cc(CN(C)C)ccc1NN1CCN(c2ccc(N)c(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C21H29F2N5O2/c1-26(2)14-15-4-7-18(20(12-15)29-3)25-28-10-8-27(9-11-28)16-5-6-17(24)19(13-16)30-21(22)23/h4-7,12-13,21,25H,8-11,14,24H2,1-3H3 |
| InChIKey | WLXMUAVJYWUAOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|