C27H32N6O — CID 164568655
7-[[2-[2,3-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-2,3-dihydroinden-1-one (PubChem CID 164568655) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 7-[[2-[2,3-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-2,3-dihydroinden-1-one.
| Compound Name | 7-[[2-[2,3-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 164568655 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 7-[[2-[2,3-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-2,3-dihydroinden-1-one |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)c(C)c2C)nc1Nc1cccc2c1C(=O)CC2 |
| InChI | InChI=1S/C27H32N6O/c1-17-16-28-27(31-26(17)29-22-7-5-6-20-8-11-24(34)25(20)22)30-21-9-10-23(19(3)18(21)2)33-14-12-32(4)13-15-33/h5-7,9-10,16H,8,11-15H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | NKTBEIMPSKCUBK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|