C24H30N4 — CID 89280057
5-methyl-2-N-(2,3,4,5-tetramethylphenyl)-4-N-(2,3,4-trimethylphenyl)pyrimidine-2,4-diamine (PubChem CID 89280057) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 5-methyl-2-N-(2,3,4,5-tetramethylphenyl)-4-N-(2,3,4-trimethylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-2-N-(2,3,4,5-tetramethylphenyl)-4-N-(2,3,4-trimethylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89280057 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 5-methyl-2-N-(2,3,4,5-tetramethylphenyl)-4-N-(2,3,4-trimethylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cc(C)c(C)c(C)c2C)nc1Nc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C24H30N4/c1-13-9-10-21(19(7)16(13)4)26-23-15(3)12-25-24(28-23)27-22-11-14(2)17(5)18(6)20(22)8/h9-12H,1-8H3,(H2,25,26,27,28) |
| InChIKey | TVWPBRRHNDYUOA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |