C20H23N9 — CID 164568765
5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,1'-cyclohexane]-2-amine (PubChem CID 164568765) has the molecular formula C20H23N9 and a molecular weight of 389.47 g/mol. Its IUPAC name is 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,1'-cyclohexane]-2-amine.
| Compound Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,1'-cyclohexane]-2-amine |
|---|---|
| PubChem CID | 164568765 |
| Molecular Formula | C20H23N9 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,1'-cyclohexane]-2-amine |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(n1)N1C(=NCC13CCCCC3)N2C |
| InChI | InChI=1S/C20H23N9/c1-13-8-16-23-12-24-28(16)10-14(13)25-18-21-9-15-17(26-18)29-19(27(15)2)22-11-20(29)6-4-3-5-7-20/h8-10,12H,3-7,11H2,1-2H3,(H,21,25,26) |
| InChIKey | WLEMRVNJDNUNIM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |