C19H21N9O2S — CID 167163686
5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1',1'-dioxospiro[7H-purino[9,8-a]imidazole-8,4'-thiane]-2-amine (PubChem CID 167163686) has the molecular formula C19H21N9O2S and a molecular weight of 439.51 g/mol. Its IUPAC name is 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1',1'-dioxospiro[7H-purino[9,8-a]imidazole-8,4'-thiane]-2-amine.
| Compound Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1',1'-dioxospiro[7H-purino[9,8-a]imidazole-8,4'-thiane]-2-amine |
|---|---|
| PubChem CID | 167163686 |
| Molecular Formula | C19H21N9O2S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1',1'-dioxospiro[7H-purino[9,8-a]imidazole-8,4'-thiane]-2-amine |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(n1)N1C(=NCC13CCS(=O)(=O)CC3)N2C |
| InChI | InChI=1S/C19H21N9O2S/c1-12-7-15-22-11-23-27(15)9-13(12)24-17-20-8-14-16(25-17)28-18(26(14)2)21-10-19(28)3-5-31(29,30)6-4-19/h7-9,11H,3-6,10H2,1-2H3,(H,20,24,25) |
| InChIKey | OJMSGZHDMYFMAN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |