C20H23N9O — CID 167163625
5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,4'-oxepane]-2-amine (PubChem CID 167163625) has the molecular formula C20H23N9O and a molecular weight of 405.47 g/mol. Its IUPAC name is 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,4'-oxepane]-2-amine.
| Compound Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,4'-oxepane]-2-amine |
|---|---|
| PubChem CID | 167163625 |
| Molecular Formula | C20H23N9O |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 5-methyl-N-(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[7H-purino[9,8-a]imidazole-8,4'-oxepane]-2-amine |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(n1)N1C(=NCC13CCCOCC3)N2C |
| InChI | InChI=1S/C20H23N9O/c1-13-8-16-23-12-24-28(16)10-14(13)25-18-21-9-15-17(26-18)29-19(27(15)2)22-11-20(29)4-3-6-30-7-5-20/h8-10,12H,3-7,11H2,1-2H3,(H,21,25,26) |
| InChIKey | SQILLTWGYZDAKO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |