C16H22O4 — CID 164571574
methyl 2-(2-ethoxy-5-ethylphenyl)oxolane-2-carboxylate (PubChem CID 164571574) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-(2-ethoxy-5-ethylphenyl)oxolane-2-carboxylate.
| Compound Name | methyl 2-(2-ethoxy-5-ethylphenyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 164571574 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl 2-(2-ethoxy-5-ethylphenyl)oxolane-2-carboxylate |
| SMILES | CCOc1ccc(CC)cc1C1(C(=O)OC)CCCO1 |
| InChI | InChI=1S/C16H22O4/c1-4-12-7-8-14(19-5-2)13(11-12)16(15(17)18-3)9-6-10-20-16/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | XDMAQQNIMSTYMM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |