C21H21F4N7O — CID 164572629
(2,2-difluorocyclobutyl)-[3-[6-[1-(difluoromethyl)pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 164572629) has the molecular formula C21H21F4N7O and a molecular weight of 463.44 g/mol. Its IUPAC name is (2,2-difluorocyclobutyl)-[3-[6-[1-(difluoromethyl)pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (2,2-difluorocyclobutyl)-[3-[6-[1-(difluoromethyl)pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 164572629 |
| Molecular Formula | C21H21F4N7O |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2,2-difluorocyclobutyl)-[3-[6-[1-(difluoromethyl)pyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | O=C(C1CCC1(F)F)N1C2CCC1CN(c1ncnn3cc(-c4cnn(C(F)F)c4)cc13)C2 |
| InChI | InChI=1S/C21H21F4N7O/c22-20(23)31-8-13(6-27-31)12-5-17-18(26-11-28-30(17)7-12)29-9-14-1-2-15(10-29)32(14)19(33)16-3-4-21(16,24)25/h5-8,11,14-16,20H,1-4,9-10H2 |
| InChIKey | BQDBXWBHMSAMNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |