C20H22FN7O — CID 164573066
[(1R,2R)-2-fluorocyclopropyl]-[3-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 164573066) has the molecular formula C20H22FN7O and a molecular weight of 395.44 g/mol. Its IUPAC name is [(1R,2R)-2-fluorocyclopropyl]-[3-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | [(1R,2R)-2-fluorocyclopropyl]-[3-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 164573066 |
| Molecular Formula | C20H22FN7O |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | [(1R,2R)-2-fluorocyclopropyl]-[3-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | Cn1cc(-c2cc3c(N4CC5CCC(C4)N5C(=O)[C@H]4C[C@H]4F)ncnn3c2)cn1 |
| InChI | InChI=1S/C20H22FN7O/c1-25-7-13(6-23-25)12-4-18-19(22-11-24-27(18)8-12)26-9-14-2-3-15(10-26)28(14)20(29)16-5-17(16)21/h4,6-8,11,14-17H,2-3,5,9-10H2,1H3/t14?,15?,16-,17+/m0/s1 |
| InChIKey | LASPCOZKXNBETL-SJJHQCBESA-N |
| XLogP | 1.67 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |