C22H30BN5O3 — CID 164573050
cyclopropyl-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 164573050) has the molecular formula C22H30BN5O3 and a molecular weight of 423.33 g/mol. Its IUPAC name is cyclopropyl-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | cyclopropyl-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 164573050 |
| Molecular Formula | C22H30BN5O3 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | cyclopropyl-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | CC1(C)OB(c2cc3c(N4CC5CCC(C4)N5C(=O)C4CC4)ncnn3c2)OC1(C)C |
| InChI | InChI=1S/C22H30BN5O3/c1-21(2)22(3,4)31-23(30-21)15-9-18-19(24-13-25-27(18)10-15)26-11-16-7-8-17(12-26)28(16)20(29)14-5-6-14/h9-10,13-14,16-17H,5-8,11-12H2,1-4H3 |
| InChIKey | KTKFCFDZYUERRN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|