C32H37F3N4O3S — CID 164575457
2-[3-(2-methyl-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 164575457) has the molecular formula C32H37F3N4O3S and a molecular weight of 614.73 g/mol. Its IUPAC name is 2-[3-(2-methyl-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(2-methyl-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 164575457 |
| Molecular Formula | C32H37F3N4O3S |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 2-[3-(2-methyl-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | Cc1cc(S(C)(=O)=O)ccc1N(CC#Cc1cc2c(N)cccc2n1CC(F)(F)F)C1CCC(N2CC3(COC3)C2)CC1 |
| InChI | InChI=1S/C32H37F3N4O3S/c1-22-15-26(43(2,40)41)12-13-29(22)38(24-10-8-23(9-11-24)37-17-31(18-37)20-42-21-31)14-4-5-25-16-27-28(36)6-3-7-30(27)39(25)19-32(33,34)35/h3,6-7,12-13,15-16,23-24H,8-11,14,17-21,36H2,1-2H3 |
| InChIKey | YXVICVJKEMWVKN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|