C31H34ClF3N4O3S — CID 167528601
2-[3-(2-chloro-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 167528601) has the molecular formula C31H34ClF3N4O3S and a molecular weight of 635.15 g/mol. Its IUPAC name is 2-[3-(2-chloro-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(2-chloro-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 167528601 |
| Molecular Formula | C31H34ClF3N4O3S |
| Molecular Weight | 635.15 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 2-[3-(2-chloro-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CS(=O)(=O)c1ccc(N(CC#Cc2cc3c(N)cccc3n2CC(F)(F)F)C2CCC(N3CC4(COC4)C3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C31H34ClF3N4O3S/c1-43(40,41)24-11-12-29(26(32)15-24)38(22-9-7-21(8-10-22)37-16-30(17-37)19-42-20-30)13-3-4-23-14-25-27(36)5-2-6-28(25)39(23)18-31(33,34)35/h2,5-6,11-12,14-15,21-22H,7-10,13,16-20,36H2,1H3 |
| InChIKey | UKXZFGPLLHBEDZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.15 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|