C32H37F3N4O4S — CID 171851860
2-[3-(2-methoxy-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 171851860) has the molecular formula C32H37F3N4O4S and a molecular weight of 630.73 g/mol. Its IUPAC name is 2-[3-(2-methoxy-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(2-methoxy-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 171851860 |
| Molecular Formula | C32H37F3N4O4S |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 2-[3-(2-methoxy-4-methylsulfonyl-N-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]anilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(S(C)(=O)=O)ccc1N(CC#Cc1cc2c(N)cccc2n1CC(F)(F)F)C1CCC(N2CC3(COC3)C2)CC1 |
| InChI | InChI=1S/C32H37F3N4O4S/c1-42-30-16-25(44(2,40)41)12-13-29(30)38(23-10-8-22(9-11-23)37-17-31(18-37)20-43-21-31)14-4-5-24-15-26-27(36)6-3-7-28(26)39(24)19-32(33,34)35/h3,6-7,12-13,15-16,22-23H,8-11,14,17-21,36H2,1-2H3 |
| InChIKey | WFLKTZQKVBJNME-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|