C18H12F5N3O — CID 164575681
N-[2-[2-(difluoromethyl)phenyl]-4,5,6-trifluoro-3-methylphenyl]-1H-pyrazole-4-carboxamide (PubChem CID 164575681) has the molecular formula C18H12F5N3O and a molecular weight of 381.30 g/mol. Its IUPAC name is N-[2-[2-(difluoromethyl)phenyl]-4,5,6-trifluoro-3-methylphenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[2-[2-(difluoromethyl)phenyl]-4,5,6-trifluoro-3-methylphenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164575681 |
| Molecular Formula | C18H12F5N3O |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-[2-(difluoromethyl)phenyl]-4,5,6-trifluoro-3-methylphenyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1c(F)c(F)c(F)c(NC(=O)c2cn[nH]c2)c1-c1ccccc1C(F)F |
| InChI | InChI=1S/C18H12F5N3O/c1-8-12(10-4-2-3-5-11(10)17(22)23)16(15(21)14(20)13(8)19)26-18(27)9-6-24-25-7-9/h2-7,17H,1H3,(H,24,25)(H,26,27) |
| InChIKey | BEHCBEDBYAXABC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|