C28H30N2O8 — CID 164577492
3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]-3-(2-carboxyethoxy)propoxy]propanoic acid (PubChem CID 164577492) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]-3-(2-carboxyethoxy)propoxy]propanoic acid.
| Compound Name | 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]-3-(2-carboxyethoxy)propoxy]propanoic acid |
|---|---|
| PubChem CID | 164577492 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]-3-(2-carboxyethoxy)propoxy]propanoic acid |
| SMILES | O=C(O)CCOCC(COCCC(=O)O)NC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C28H30N2O8/c31-25(29-23(18-37-15-13-27(33)34)19-38-16-14-28(35)36)11-12-26(32)30-17-22-7-2-1-5-20(22)9-10-21-6-3-4-8-24(21)30/h1-8,23H,11-19H2,(H,29,31)(H,33,34)(H,35,36) |
| InChIKey | DKSZGYWNUYWRNE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|