C25H31NO3 — CID 164579276
(2R,3R)-N-benzyl-3-cyclohexyloxy-2-(4-methoxyphenyl)pent-4-enamide (PubChem CID 164579276) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(4-methoxyphenyl)pent-4-enamide.
| Compound Name | (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(4-methoxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 164579276 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(4-methoxyphenyl)pent-4-enamide |
| SMILES | C=C[C@@H](OC1CCCCC1)[C@H](C(=O)NCc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-3-23(29-22-12-8-5-9-13-22)24(20-14-16-21(28-2)17-15-20)25(27)26-18-19-10-6-4-7-11-19/h3-4,6-7,10-11,14-17,22-24H,1,5,8-9,12-13,18H2,2H3,(H,26,27)/t23-,24-/m1/s1 |
| InChIKey | UDGJJKBDOWYSAH-DNQXCXABSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|