C27H31NO4 — CID 164579280
(2R,3R)-N-benzyl-3-cyclohexyloxy-2-(6-methoxy-1-benzofuran-3-yl)pent-4-enamide (PubChem CID 164579280) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(6-methoxy-1-benzofuran-3-yl)pent-4-enamide.
| Compound Name | (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(6-methoxy-1-benzofuran-3-yl)pent-4-enamide |
|---|---|
| PubChem CID | 164579280 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (2R,3R)-N-benzyl-3-cyclohexyloxy-2-(6-methoxy-1-benzofuran-3-yl)pent-4-enamide |
| SMILES | C=C[C@@H](OC1CCCCC1)[C@H](C(=O)NCc1ccccc1)c1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C27H31NO4/c1-3-24(32-20-12-8-5-9-13-20)26(27(29)28-17-19-10-6-4-7-11-19)23-18-31-25-16-21(30-2)14-15-22(23)25/h3-4,6-7,10-11,14-16,18,20,24,26H,1,5,8-9,12-13,17H2,2H3,(H,28,29)/t24-,26-/m1/s1 |
| InChIKey | QOMRSHPHUDUNJR-AOYPEHQESA-N |
| XLogP | 5.75 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|