C28H31NO2 — CID 164579293
(2R,3R)-N-benzyl-2-(4-methylphenyl)-3-(3-phenylpropoxy)pent-4-enamide (PubChem CID 164579293) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-2-(4-methylphenyl)-3-(3-phenylpropoxy)pent-4-enamide.
| Compound Name | (2R,3R)-N-benzyl-2-(4-methylphenyl)-3-(3-phenylpropoxy)pent-4-enamide |
|---|---|
| PubChem CID | 164579293 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (2R,3R)-N-benzyl-2-(4-methylphenyl)-3-(3-phenylpropoxy)pent-4-enamide |
| SMILES | C=C[C@@H](OCCCc1ccccc1)[C@H](C(=O)NCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H31NO2/c1-3-26(31-20-10-15-23-11-6-4-7-12-23)27(25-18-16-22(2)17-19-25)28(30)29-21-24-13-8-5-9-14-24/h3-9,11-14,16-19,26-27H,1,10,15,20-21H2,2H3,(H,29,30)/t26-,27-/m1/s1 |
| InChIKey | NLVDZPKZZGBHIK-KAYWLYCHSA-N |
| XLogP | 5.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|