About CID 164583208
CID 164583208 (PubChem CID 164583208) has the molecular formula C13H8BNO
and a molecular weight of 205.03 g/mol.
Molecular Properties
| Compound Name | CID 164583208 |
| PubChem CID | 164583208 |
| Molecular Formula | C13H8BNO |
| Molecular Weight | 205.03 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(-c3ccncc3)cccc2o1 |
| InChI | InChI=1S/C13H8BNO/c14-13-8-11-10(2-1-3-12(11)16-13)9-4-6-15-7-5-9/h1-8H |
| InChIKey | WZAOAZQVHOSCLX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.03 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164583208 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164583208?
The IUPAC name of CID 164583208 (CID 164583208) is not available.
What is the SMILES notation for CID 164583208?
The canonical SMILES for CID 164583208 is [B]c1cc2c(-c3ccncc3)cccc2o1.
What is the InChIKey of CID 164583208?
The InChIKey is WZAOAZQVHOSCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BNO/c14-13-8-11-10(2-1-3-12(11)16-13)9-4-6-15-7-5-9/h1-8H.
What are the key properties of CID 164583208?
CID 164583208 has a molecular weight of 205.03 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164583208 is sourced from PubChem (CID 164583208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).