C14H13N2P+2 — CID 164584870
1,3-diphenyl-2H-1,3,2-diazaphosphole-1,3-diium (PubChem CID 164584870) has the molecular formula C14H13N2P+2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 1,3-diphenyl-2H-1,3,2-diazaphosphole-1,3-diium.
| Compound Name | 1,3-diphenyl-2H-1,3,2-diazaphosphole-1,3-diium |
|---|---|
| PubChem CID | 164584870 |
| Molecular Formula | C14H13N2P+2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1,3-diphenyl-2H-1,3,2-diazaphosphole-1,3-diium |
| SMILES | c1ccc(-[n+]2cc[n+](-c3ccccc3)[pH]2)cc1 |
| InChI | InChI=1S/C14H13N2P/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-12,17H/q+2 |
| InChIKey | RIDANFMJDBFNJX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |