C15H14N2O2 — CID 164589291
2-(4-ethoxyphenyl)-1-hydroxypyrrolo[2,3-c]pyridine (PubChem CID 164589291) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-hydroxypyrrolo[2,3-c]pyridine.
| Compound Name | 2-(4-ethoxyphenyl)-1-hydroxypyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164589291 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-hydroxypyrrolo[2,3-c]pyridine |
| SMILES | CCOc1ccc(-c2cc3ccncc3n2O)cc1 |
| InChI | InChI=1S/C15H14N2O2/c1-2-19-13-5-3-11(4-6-13)14-9-12-7-8-16-10-15(12)17(14)18/h3-10,18H,2H2,1H3 |
| InChIKey | AVSZWDXMJQWIJN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|