C15H15N3O2 — CID 163318042
3-(4-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyrazine (PubChem CID 163318042) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyrazine.
| Compound Name | 3-(4-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 163318042 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyrazine |
| SMILES | CCOc1ccc(-c2cnc3c(OC)nccn23)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-3-20-12-6-4-11(5-7-12)13-10-17-14-15(19-2)16-8-9-18(13)14/h4-10H,3H2,1-2H3 |
| InChIKey | ABHVLKYYXDHQMA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |