C14H13N3O2 — CID 163309525
[3-(8-methoxyimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol (PubChem CID 163309525) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is [3-(8-methoxyimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol.
| Compound Name | [3-(8-methoxyimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 163309525 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | [3-(8-methoxyimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol |
| SMILES | COc1nccn2c(-c3cccc(CO)c3)cnc12 |
| InChI | InChI=1S/C14H13N3O2/c1-19-14-13-16-8-12(17(13)6-5-15-14)11-4-2-3-10(7-11)9-18/h2-8,18H,9H2,1H3 |
| InChIKey | SOTIARRMXCMHJH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |