C16H19NO5S — CID 164590240
2-(cyclohexanecarbonylamino)-6-methyl-5-oxo-7H-thieno[3,2-b]pyran-6-carboxylic acid (PubChem CID 164590240) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-6-methyl-5-oxo-7H-thieno[3,2-b]pyran-6-carboxylic acid.
| Compound Name | 2-(cyclohexanecarbonylamino)-6-methyl-5-oxo-7H-thieno[3,2-b]pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 164590240 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-6-methyl-5-oxo-7H-thieno[3,2-b]pyran-6-carboxylic acid |
| SMILES | CC1(C(=O)O)Cc2sc(NC(=O)C3CCCCC3)cc2OC1=O |
| InChI | InChI=1S/C16H19NO5S/c1-16(14(19)20)8-11-10(22-15(16)21)7-12(23-11)17-13(18)9-5-3-2-4-6-9/h7,9H,2-6,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | SDSJJSQNFXMKBG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|